Hydrocarbons

Consider the following transformations of a compound P.

Choose the correct option(s).

Choose the correct option(s) for the following set of reactions

Which of the following reactions produce(s) propane as a major product?

Choose the correct option(s) that give(s) an aromatic compound as the major product

Choose the correct option(s) for the following reaction sequence

Consider Q, R and S as major products

Total number of hydroxyl groups present in a molecule of the major product P is ______

The reaction(s) leading to the formation of 1,3,5-trimethylbenzene is (are)

The compound Z is

Aniline reacts with mixed acid (conc. $\mathrm{HNO_3}$ and conc. $\mathrm{H_2SO_4}$) at 288 K to give P (51 %), Q (47%) and R (2%). The major product(s) of the following reaction sequence is (are)

R → [1) Ac$_2$O, pyridine; 2) Br$_2$, CH$_3$CO$_2$H; 3) H$_3$O$^+$; 4) NaNO$_2$, HCl/273-278 K; 5) EtOH, Δ] → S → [1) Sn/HCl; 2) Br$_2$/H$_2$O (excess); 3) NaNO$_2$, HCl/273-278 K; 4) H$_3$PO$_2$] → major product(s)

The correct statement(s) for the following addition reactions is(are)

(i) trans-2-butene $\xrightarrow{\ce{Br2/CHCl3}}$ M and N

(ii) cis-2-butene $\xrightarrow{\ce{Br2/CHCl3}}$ O and P

The only CORRECT combination in which the reaction proceeds through radical mechanism is

Compounds P and R upon ozonolysis produce Q and S, respectively. The molecular formula of Q and S is $\ce{C8H8O}$. Q undergoes Cannizzaro reaction but not haloform reaction, whereas S undergoes haloform reaction but not Cannizzaro reaction.

(i) P $\xrightarrow{\text{i) } \ce{O3/CH2Cl2};\ \text{ii) } \ce{Zn/H2O}}$ Q ($\ce{C8H8O}$)

(ii) R $\xrightarrow{\text{i) } \ce{O3/CH2Cl2};\ \text{ii) } \ce{Zn/H2O}}$ S ($\ce{C8H8O}$)

The option(s) with suitable combination of P and R, respectively, is(are)

The product S is

The reactions, Q to R and R to S, are

Which of the following compounds will form significant amount of meta product during mono-nitration reaction ?

3-Methyl-pent-2-ene on reaction with HBr in presence of peroxide forms an addition product. The number of possible stereoisomers for the product is :

Which of the following compounds will not undergo Friedel Craft's reaction with benzene ?

The major product of the following reaction is :
$$\ce{C6H5CH2-C(CH3)(Br)-CH2-CH3 ->[C2H5ONa][C2H5OH]}$$

The major product of the following reaction is :

On complete hydrogenation, natural rubber produces