Alkenes

In the reaction given below, the total number of atoms having $sp^2$ hybridization in the major product $\mathbf P$ is ____.

What is the major product formed by HI on reaction with $\mathrm{(CH_3)_3C{-}CH{=}CH_2}$ ?

Identify products A and B.

1-Methylcyclopentene is treated with dil. KMnO$_4$ at 273 K to give A, which with CrO$_3$ gives B.

Consider the following transformations of a compound P.

Choose the correct option(s).

Choose the correct option(s) for the following set of reactions

Total number of hydroxyl groups present in a molecule of the major product P is ______

The correct statement(s) for the following addition reactions is(are)

(i) trans-2-butene $\xrightarrow{\ce{Br2/CHCl3}}$ M and N

(ii) cis-2-butene $\xrightarrow{\ce{Br2/CHCl3}}$ O and P

Compounds P and R upon ozonolysis produce Q and S, respectively. The molecular formula of Q and S is $\ce{C8H8O}$. Q undergoes Cannizzaro reaction but not haloform reaction, whereas S undergoes haloform reaction but not Cannizzaro reaction.

(i) P $\xrightarrow{\text{i) } \ce{O3/CH2Cl2};\ \text{ii) } \ce{Zn/H2O}}$ Q ($\ce{C8H8O}$)

(ii) R $\xrightarrow{\text{i) } \ce{O3/CH2Cl2};\ \text{ii) } \ce{Zn/H2O}}$ S ($\ce{C8H8O}$)

The option(s) with suitable combination of P and R, respectively, is(are)

3-Methyl-pent-2-ene on reaction with HBr in presence of peroxide forms an addition product. The number of possible stereoisomers for the product is :

The major product of the following reaction is :
$$\ce{C6H5CH2-C(CH3)(Br)-CH2-CH3 ->[C2H5ONa][C2H5OH]}$$

The major product of the following reaction is :

On complete hydrogenation, natural rubber produces

The product of the reaction given below is :

The reaction of propene with HOCl ($\ce{Cl2 + H2O}$) proceeds through the intermediate :

The hydrocarbon with seven carbon atoms containing a neopentyl and a vinyl group is :

Bromination of cyclohexene under conditions given below yields :

Compound(s) that on hydrogenation produce(s) optically inactive compound(s) is(are)

In the following reaction, the major product is

The number of hydroxyl group(s) in Q is

In the following reactions, the product S is